C27H34ClNO5Si — CID 153449250
8-[(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-1-methylpiperidin-4-yl]-2-(2-chlorophenyl)-5,7-dihydroxychromen-4-one (PubChem CID 153449250) has the molecular formula C27H34ClNO5Si and a molecular weight of 516.11 g/mol. Its IUPAC name is 8-[(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-1-methylpiperidin-4-yl]-2-(2-chlorophenyl)-5,7-dihydroxychromen-4-one.
| Compound Name | 8-[(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-1-methylpiperidin-4-yl]-2-(2-chlorophenyl)-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 153449250 |
| Molecular Formula | C27H34ClNO5Si |
| Molecular Weight | 516.11 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 8-[(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-1-methylpiperidin-4-yl]-2-(2-chlorophenyl)-5,7-dihydroxychromen-4-one |
| SMILES | CN1CC[C@H](c2c(O)cc(O)c3c(=O)cc(-c4ccccc4Cl)oc23)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C27H34ClNO5Si/c1-27(2,3)35(5,6)34-23-15-29(4)12-11-17(23)24-19(30)13-20(31)25-21(32)14-22(33-26(24)25)16-9-7-8-10-18(16)28/h7-10,13-14,17,23,30-31H,11-12,15H2,1-6H3/t17-,23+/m0/s1 |
| InChIKey | OJOSSBYLSGNKFS-GAJHUEQPSA-N |
| XLogP | 6.33 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.11 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|