C29H37ClNO8P — CID 146669223
ditert-butyl [2-(2-chlorophenyl)-5-hydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-4-oxochromen-7-yl] phosphate (PubChem CID 146669223) has the molecular formula C29H37ClNO8P and a molecular weight of 594.04 g/mol. Its IUPAC name is ditert-butyl [2-(2-chlorophenyl)-5-hydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-4-oxochromen-7-yl] phosphate.
| Compound Name | ditert-butyl [2-(2-chlorophenyl)-5-hydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-4-oxochromen-7-yl] phosphate |
|---|---|
| PubChem CID | 146669223 |
| Molecular Formula | C29H37ClNO8P |
| Molecular Weight | 594.04 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | ditert-butyl [2-(2-chlorophenyl)-5-hydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-4-oxochromen-7-yl] phosphate |
| SMILES | CN1CC[C@H](c2c(OP(=O)(OC(C)(C)C)OC(C)(C)C)cc(O)c3c(=O)cc(-c4ccccc4Cl)oc23)[C@H](O)C1 |
| InChI | InChI=1S/C29H37ClNO8P/c1-28(2,3)38-40(35,39-29(4,5)6)37-24-15-21(33)26-20(32)14-23(17-10-8-9-11-19(17)30)36-27(26)25(24)18-12-13-31(7)16-22(18)34/h8-11,14-15,18,22,33-34H,12-13,16H2,1-7H3/t18-,22+/m0/s1 |
| InChIKey | KUGVBZUBKREJPX-PGRDOPGGSA-N |
| XLogP | 6.72 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.04 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|