C25H29ClNO8P — CID 122700831
[2-(2-chlorophenyl)-5-hydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)-4-oxochromen-7-yl] diethyl phosphate (PubChem CID 122700831) has the molecular formula C25H29ClNO8P and a molecular weight of 537.93 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-5-hydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)-4-oxochromen-7-yl] diethyl phosphate.
| Compound Name | [2-(2-chlorophenyl)-5-hydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)-4-oxochromen-7-yl] diethyl phosphate |
|---|---|
| PubChem CID | 122700831 |
| Molecular Formula | C25H29ClNO8P |
| Molecular Weight | 537.93 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | [2-(2-chlorophenyl)-5-hydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)-4-oxochromen-7-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)Oc1cc(O)c2c(=O)cc(-c3ccccc3Cl)oc2c1C1CCN(C)CC1O |
| InChI | InChI=1S/C25H29ClNO8P/c1-4-32-36(31,33-5-2)35-22-13-19(29)24-18(28)12-21(15-8-6-7-9-17(15)26)34-25(24)23(22)16-10-11-27(3)14-20(16)30/h6-9,12-13,16,20,29-30H,4-5,10-11,14H2,1-3H3 |
| InChIKey | IQLRZMGXPCYGIJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.93 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|