C23H23ClN2O7 — CID 67407987
2-(2-chloro-3-nitrophenyl)-8-[(2S,3R)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]-5,7-dimethoxychromen-4-one (PubChem CID 67407987) has the molecular formula C23H23ClN2O7 and a molecular weight of 474.90 g/mol. Its IUPAC name is 2-(2-chloro-3-nitrophenyl)-8-[(2S,3R)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]-5,7-dimethoxychromen-4-one.
| Compound Name | 2-(2-chloro-3-nitrophenyl)-8-[(2S,3R)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]-5,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 67407987 |
| Molecular Formula | C23H23ClN2O7 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 2-(2-chloro-3-nitrophenyl)-8-[(2S,3R)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]-5,7-dimethoxychromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(-c3cccc([N+](=O)[O-])c3Cl)oc2c1[C@H]1CCN(C)[C@@H]1CO |
| InChI | InChI=1S/C23H23ClN2O7/c1-25-8-7-12(15(25)11-27)20-18(31-2)10-19(32-3)21-16(28)9-17(33-23(20)21)13-5-4-6-14(22(13)24)26(29)30/h4-6,9-10,12,15,27H,7-8,11H2,1-3H3/t12-,15+/m0/s1 |
| InChIKey | AFZFGSHWVZIGBW-SWLSCSKDSA-N |
| XLogP | 3.82 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|