About 4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide
4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 66936094) has the molecular formula C20H14N2O3S
and a molecular weight of 362.41 g/mol. Its IUPAC name is 4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide |
| PubChem CID | 66936094 |
| Molecular Formula | C20H14N2O3S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | NC(=O)c1sc2[nH]c(=O)c(-c3ccccc3)c(O)c2c1-c1ccccc1 |
| InChI | InChI=1S/C20H14N2O3S/c21-18(24)17-13(11-7-3-1-4-8-11)15-16(23)14(12-9-5-2-6-10-12)19(25)22-20(15)26-17/h1-10H,(H2,21,24)(H2,22,23,25) |
| InChIKey | ULOLSJLRFDENMD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide?
The IUPAC name of 4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide (CID 66936094) is 4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide.
What is the SMILES notation for 4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide?
The canonical SMILES for 4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide is NC(=O)c1sc2[nH]c(=O)c(-c3ccccc3)c(O)c2c1-c1ccccc1.
What is the InChIKey of 4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide?
The InChIKey is ULOLSJLRFDENMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2O3S/c21-18(24)17-13(11-7-3-1-4-8-11)15-16(23)14(12-9-5-2-6-10-12)19(25)22-20(15)26-17/h1-10H,(H2,21,24)(H2,22,23,25).
What are the key properties of 4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide?
4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide has a molecular weight of 362.41 g/mol, XLogP of 3.73, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-6-oxo-3,5-diphenyl-7H-thieno[2,3-b]pyridine-2-carboxamide is sourced from PubChem (CID 66936094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).