C16H22N2O2 — CID 66936383
(9aR)-9a-benzyl-3,4,6,7,8,9-hexahydro-1H-pyrido[1,2-a]pyrazine-2-carboxylic acid (PubChem CID 66936383) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is (9aR)-9a-benzyl-3,4,6,7,8,9-hexahydro-1H-pyrido[1,2-a]pyrazine-2-carboxylic acid.
| Compound Name | (9aR)-9a-benzyl-3,4,6,7,8,9-hexahydro-1H-pyrido[1,2-a]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 66936383 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (9aR)-9a-benzyl-3,4,6,7,8,9-hexahydro-1H-pyrido[1,2-a]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)N1CCN2CCCC[C@@]2(Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H22N2O2/c19-15(20)17-10-11-18-9-5-4-8-16(18,13-17)12-14-6-2-1-3-7-14/h1-3,6-7H,4-5,8-13H2,(H,19,20)/t16-/m1/s1 |
| InChIKey | UQVHQGYZLNAKCT-MRXNPFEDSA-N |
| XLogP | 2.45 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |