C23H24N4O3 — CID 66938714
(10R,15S)-13-[2-(dimethylamino)ethyl]-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 66938714) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is (10R,15S)-13-[2-(dimethylamino)ethyl]-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | (10R,15S)-13-[2-(dimethylamino)ethyl]-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 66938714 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (10R,15S)-13-[2-(dimethylamino)ethyl]-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | CN(C)CCN1C(=O)[C@@H]2Cc3c([nH]c4ccccc34)[C@@H](c3cccc(O)c3)N2C1=O |
| InChI | InChI=1S/C23H24N4O3/c1-25(2)10-11-26-22(29)19-13-17-16-8-3-4-9-18(16)24-20(17)21(27(19)23(26)30)14-6-5-7-15(28)12-14/h3-9,12,19,21,24,28H,10-11,13H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | LDOHZXPMAHHCSU-PZJWPPBQSA-N |
| XLogP | 2.71 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|