C15H18N4O — CID 66940614
N'-[6-[(4-methoxyphenyl)methyl]pyridazin-3-yl]-N,N-dimethylmethanimidamide (PubChem CID 66940614) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is N'-[6-[(4-methoxyphenyl)methyl]pyridazin-3-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[6-[(4-methoxyphenyl)methyl]pyridazin-3-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 66940614 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N'-[6-[(4-methoxyphenyl)methyl]pyridazin-3-yl]-N,N-dimethylmethanimidamide |
| SMILES | COc1ccc(Cc2ccc(/N=C/N(C)C)nn2)cc1 |
| InChI | InChI=1S/C15H18N4O/c1-19(2)11-16-15-9-6-13(17-18-15)10-12-4-7-14(20-3)8-5-12/h4-9,11H,10H2,1-3H3/b16-11+ |
| InChIKey | HBGSGXJIQNKTND-LFIBNONCSA-N |
| XLogP | 2.30 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|