C17H17ClN4O2S — CID 66940785
6-[(3-chlorophenyl)methylsulfanyl]-N-(2-methoxyethyl)imidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 66940785) has the molecular formula C17H17ClN4O2S and a molecular weight of 376.87 g/mol. Its IUPAC name is 6-[(3-chlorophenyl)methylsulfanyl]-N-(2-methoxyethyl)imidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 6-[(3-chlorophenyl)methylsulfanyl]-N-(2-methoxyethyl)imidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 66940785 |
| Molecular Formula | C17H17ClN4O2S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 6-[(3-chlorophenyl)methylsulfanyl]-N-(2-methoxyethyl)imidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | COCCNC(=O)c1cnc2ccc(SCc3cccc(Cl)c3)nn12 |
| InChI | InChI=1S/C17H17ClN4O2S/c1-24-8-7-19-17(23)14-10-20-15-5-6-16(21-22(14)15)25-11-12-3-2-4-13(18)9-12/h2-6,9-10H,7-8,11H2,1H3,(H,19,23) |
| InChIKey | KXTQCIASVZVMFW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|