C26H39NO9 — CID 66945679
(2S)-2-amino-3-[3,4-bis(2-methylpropanoyloxy)phenyl]-4-methyl-5-(3-methylbutoxycarbonyloxy)pentanoic acid (PubChem CID 66945679) has the molecular formula C26H39NO9 and a molecular weight of 509.60 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(2-methylpropanoyloxy)phenyl]-4-methyl-5-(3-methylbutoxycarbonyloxy)pentanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(2-methylpropanoyloxy)phenyl]-4-methyl-5-(3-methylbutoxycarbonyloxy)pentanoic acid |
|---|---|
| PubChem CID | 66945679 |
| Molecular Formula | C26H39NO9 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(2-methylpropanoyloxy)phenyl]-4-methyl-5-(3-methylbutoxycarbonyloxy)pentanoic acid |
| SMILES | CC(C)CCOC(=O)OCC(C)C(c1ccc(OC(=O)C(C)C)c(OC(=O)C(C)C)c1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C26H39NO9/c1-14(2)10-11-33-26(32)34-13-17(7)21(22(27)23(28)29)18-8-9-19(35-24(30)15(3)4)20(12-18)36-25(31)16(5)6/h8-9,12,14-17,21-22H,10-11,13,27H2,1-7H3,(H,28,29)/t17?,21?,22-/m0/s1 |
| InChIKey | VJRFFQBWXRULLJ-IVXJCAOYSA-N |
| XLogP | 4.14 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|