C28H43NO10 — CID 66946460
(2S)-2-amino-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-5-(2,2-dimethylpropanoyloxy)-4-methylhexanoic acid (PubChem CID 66946460) has the molecular formula C28H43NO10 and a molecular weight of 553.65 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-5-(2,2-dimethylpropanoyloxy)-4-methylhexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-5-(2,2-dimethylpropanoyloxy)-4-methylhexanoic acid |
|---|---|
| PubChem CID | 66946460 |
| Molecular Formula | C28H43NO10 |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-5-(2,2-dimethylpropanoyloxy)-4-methylhexanoic acid |
| SMILES | CC(C)COC(=O)Oc1ccc(C(C(C)C(C)OC(=O)C(C)(C)C)[C@H](N)C(=O)O)cc1OC(=O)OCC(C)C |
| InChI | InChI=1S/C28H43NO10/c1-15(2)13-35-26(33)38-20-11-10-19(12-21(20)39-27(34)36-14-16(3)4)22(23(29)24(30)31)17(5)18(6)37-25(32)28(7,8)9/h10-12,15-18,22-23H,13-14,29H2,1-9H3,(H,30,31)/t17?,18?,22?,23-/m0/s1 |
| InChIKey | MRUPGSVOTURXGC-XTUZSGGNSA-N |
| XLogP | 5.14 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|