C29H45NO10 — CID 66949923
(2S)-2-amino-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-5-(2,3-dimethylbutanoyloxy)-4-methylhexanoic acid (PubChem CID 66949923) has the molecular formula C29H45NO10 and a molecular weight of 567.68 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-5-(2,3-dimethylbutanoyloxy)-4-methylhexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-5-(2,3-dimethylbutanoyloxy)-4-methylhexanoic acid |
|---|---|
| PubChem CID | 66949923 |
| Molecular Formula | C29H45NO10 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-5-(2,3-dimethylbutanoyloxy)-4-methylhexanoic acid |
| SMILES | CC(C)COC(=O)Oc1ccc(C(C(C)C(C)OC(=O)C(C)C(C)C)[C@H](N)C(=O)O)cc1OC(=O)OCC(C)C |
| InChI | InChI=1S/C29H45NO10/c1-15(2)13-36-28(34)39-22-11-10-21(12-23(22)40-29(35)37-14-16(3)4)24(25(30)26(31)32)19(8)20(9)38-27(33)18(7)17(5)6/h10-12,15-20,24-25H,13-14,30H2,1-9H3,(H,31,32)/t18?,19?,20?,24?,25-/m0/s1 |
| InChIKey | GUVOPBJHEKQRPS-BCVZMELASA-N |
| XLogP | 5.38 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|