C31H49NO9 — CID 66952389
(2S)-2-amino-3-[3,4-bis(2,3-dimethylbutanoyloxy)phenyl]-4-methyl-5-(2-methylbutoxycarbonyloxy)hexanoic acid (PubChem CID 66952389) has the molecular formula C31H49NO9 and a molecular weight of 579.73 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(2,3-dimethylbutanoyloxy)phenyl]-4-methyl-5-(2-methylbutoxycarbonyloxy)hexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(2,3-dimethylbutanoyloxy)phenyl]-4-methyl-5-(2-methylbutoxycarbonyloxy)hexanoic acid |
|---|---|
| PubChem CID | 66952389 |
| Molecular Formula | C31H49NO9 |
| Molecular Weight | 579.73 g/mol |
| Exact Mass | 579.34 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(2,3-dimethylbutanoyloxy)phenyl]-4-methyl-5-(2-methylbutoxycarbonyloxy)hexanoic acid |
| SMILES | CCC(C)COC(=O)OC(C)C(C)C(c1ccc(OC(=O)C(C)C(C)C)c(OC(=O)C(C)C(C)C)c1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C31H49NO9/c1-11-18(6)15-38-31(37)39-22(10)21(9)26(27(32)28(33)34)23-12-13-24(40-29(35)19(7)16(2)3)25(14-23)41-30(36)20(8)17(4)5/h12-14,16-22,26-27H,11,15,32H2,1-10H3,(H,33,34)/t18?,19?,20?,21?,22?,26?,27-/m0/s1 |
| InChIKey | YRMBQXYVNZSWHM-UATARZJJSA-N |
| XLogP | 5.80 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.73 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|