C20H29NO8 — CID 66946781
(2R)-5-acetyloxy-3-(3,4-dihydroxyphenyl)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 66946781) has the molecular formula C20H29NO8 and a molecular weight of 411.45 g/mol. Its IUPAC name is (2R)-5-acetyloxy-3-(3,4-dihydroxyphenyl)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2R)-5-acetyloxy-3-(3,4-dihydroxyphenyl)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 66946781 |
| Molecular Formula | C20H29NO8 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (2R)-5-acetyloxy-3-(3,4-dihydroxyphenyl)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC(=O)OC(C)C(C)C(c1ccc(O)c(O)c1)[C@@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C20H29NO8/c1-10(11(2)28-12(3)22)16(13-7-8-14(23)15(24)9-13)17(18(25)26)21-19(27)29-20(4,5)6/h7-11,16-17,23-24H,1-6H3,(H,21,27)(H,25,26)/t10?,11?,16?,17-/m1/s1 |
| InChIKey | PJPRANSKRSXZRP-DUTCDRGVSA-N |
| XLogP | 2.75 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|