About 3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate
3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate (PubChem CID 66953049) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is 3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate |
| PubChem CID | 66953049 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate |
| SMILES | C=CCOC(=O)[C@@H]1CCNC[C@@H]1C(=O)OC |
| InChI | InChI=1S/C11H17NO4/c1-3-6-16-11(14)8-4-5-12-7-9(8)10(13)15-2/h3,8-9,12H,1,4-7H2,2H3/t8-,9+/m1/s1 |
| InChIKey | SNJUWZVOUQUCER-BDAKNGLRSA-N |
| XLogP | 0.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate?
The IUPAC name of 3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate (CID 66953049) is 3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate.
What is the SMILES notation for 3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate?
The canonical SMILES for 3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate is C=CCOC(=O)[C@@H]1CCNC[C@@H]1C(=O)OC.
What is the InChIKey of 3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate?
The InChIKey is SNJUWZVOUQUCER-BDAKNGLRSA-N. The full InChI is InChI=1S/C11H17NO4/c1-3-6-16-11(14)8-4-5-12-7-9(8)10(13)15-2/h3,8-9,12H,1,4-7H2,2H3/t8-,9+/m1/s1.
What are the key properties of 3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate?
3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate has a molecular weight of 227.26 g/mol, XLogP of 0.11, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-methyl 4-O-prop-2-enyl (3R,4R)-piperidine-3,4-dicarboxylate is sourced from PubChem (CID 66953049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).