C16H15IN2O2 — CID 66953519
7-iodo-N-[(4-methoxyphenyl)methyl]-6-methyl-1,2-benzoxazol-3-amine (PubChem CID 66953519) has the molecular formula C16H15IN2O2 and a molecular weight of 394.21 g/mol. Its IUPAC name is 7-iodo-N-[(4-methoxyphenyl)methyl]-6-methyl-1,2-benzoxazol-3-amine.
| Compound Name | 7-iodo-N-[(4-methoxyphenyl)methyl]-6-methyl-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 66953519 |
| Molecular Formula | C16H15IN2O2 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 7-iodo-N-[(4-methoxyphenyl)methyl]-6-methyl-1,2-benzoxazol-3-amine |
| SMILES | COc1ccc(CNc2noc3c(I)c(C)ccc23)cc1 |
| InChI | InChI=1S/C16H15IN2O2/c1-10-3-8-13-15(14(10)17)21-19-16(13)18-9-11-4-6-12(20-2)7-5-11/h3-8H,9H2,1-2H3,(H,18,19) |
| InChIKey | BGHRGADLRPQSAB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|