C8H8BrClFN — CID 66953951
3-bromo-6-chloro-2-fluoro-N,N-dimethylaniline (PubChem CID 66953951) has the molecular formula C8H8BrClFN and a molecular weight of 252.51 g/mol. Its IUPAC name is 3-bromo-6-chloro-2-fluoro-N,N-dimethylaniline.
| Compound Name | 3-bromo-6-chloro-2-fluoro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 66953951 |
| Molecular Formula | C8H8BrClFN |
| Molecular Weight | 252.51 g/mol |
| Exact Mass | 250.95 |
| IUPAC Name | 3-bromo-6-chloro-2-fluoro-N,N-dimethylaniline |
| SMILES | CN(C)c1c(Cl)ccc(Br)c1F |
| InChI | InChI=1S/C8H8BrClFN/c1-12(2)8-6(10)4-3-5(9)7(8)11/h3-4H,1-2H3 |
| InChIKey | KLHDSFCEUDFXOA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|