C21H18FN3O — CID 66954386
2-(4-fluorophenyl)-N-[(Z)-(8-methylquinolin-6-yl)methylideneamino]cyclopropane-1-carboxamide (PubChem CID 66954386) has the molecular formula C21H18FN3O and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[(Z)-(8-methylquinolin-6-yl)methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[(Z)-(8-methylquinolin-6-yl)methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 66954386 |
| Molecular Formula | C21H18FN3O |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[(Z)-(8-methylquinolin-6-yl)methylideneamino]cyclopropane-1-carboxamide |
| SMILES | Cc1cc(/C=N\NC(=O)C2CC2c2ccc(F)cc2)cc2cccnc12 |
| InChI | InChI=1S/C21H18FN3O/c1-13-9-14(10-16-3-2-8-23-20(13)16)12-24-25-21(26)19-11-18(19)15-4-6-17(22)7-5-15/h2-10,12,18-19H,11H2,1H3,(H,25,26)/b24-12- |
| InChIKey | GYYSOBXJKXWXOC-MSXFZWOLSA-N |
| XLogP | 3.94 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|