C20H16ClN3O — CID 66954825
N-[(Z)-(8-chloroquinolin-6-yl)methylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 66954825) has the molecular formula C20H16ClN3O and a molecular weight of 349.82 g/mol. Its IUPAC name is N-[(Z)-(8-chloroquinolin-6-yl)methylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | N-[(Z)-(8-chloroquinolin-6-yl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 66954825 |
| Molecular Formula | C20H16ClN3O |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[(Z)-(8-chloroquinolin-6-yl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Cl)c2ncccc2c1)C1CC1c1ccccc1 |
| InChI | InChI=1S/C20H16ClN3O/c21-18-10-13(9-15-7-4-8-22-19(15)18)12-23-24-20(25)17-11-16(17)14-5-2-1-3-6-14/h1-10,12,16-17H,11H2,(H,24,25)/b23-12- |
| InChIKey | AEEZPLOFQLTNDU-FMCGGJTJSA-N |
| XLogP | 4.14 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|