C7H15ClN2 — CID 66956307
1-ethenyl-2,3-dimethylimidazolidin-1-ium chloride (PubChem CID 66956307) has the molecular formula C7H15ClN2 and a molecular weight of 162.66 g/mol. Its IUPAC name is 1-ethenyl-2,3-dimethylimidazolidin-1-ium chloride.
| Compound Name | 1-ethenyl-2,3-dimethylimidazolidin-1-ium chloride |
|---|---|
| PubChem CID | 66956307 |
| Molecular Formula | C7H15ClN2 |
| Molecular Weight | 162.66 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1-ethenyl-2,3-dimethylimidazolidin-1-ium chloride |
| SMILES | C=C[NH+]1CCN(C)C1C.[Cl-] |
| InChI | InChI=1S/C7H14N2.ClH/c1-4-9-6-5-8(3)7(9)2;/h4,7H,1,5-6H2,2-3H3;1H |
| InChIKey | HTJPXZLCIQAUTM-UHFFFAOYSA-N |
| XLogP | -3.69 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.66 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |