C16H19NO3S — CID 66958950
1-azabicyclo[2.2.2]octan-3-yl 2-hydroxy-2-thiophen-2-ylpent-3-ynoate (PubChem CID 66958950) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl 2-hydroxy-2-thiophen-2-ylpent-3-ynoate.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl 2-hydroxy-2-thiophen-2-ylpent-3-ynoate |
|---|---|
| PubChem CID | 66958950 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl 2-hydroxy-2-thiophen-2-ylpent-3-ynoate |
| SMILES | CC#CC(O)(C(=O)OC1CN2CCC1CC2)c1cccs1 |
| InChI | InChI=1S/C16H19NO3S/c1-2-7-16(19,14-4-3-10-21-14)15(18)20-13-11-17-8-5-12(13)6-9-17/h3-4,10,12-13,19H,5-6,8-9,11H2,1H3 |
| InChIKey | SDYOYIXOSHYFHA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|