C20H23N5O5 — CID 66959591
methyl N-[2-[[7-(3,4-dimethoxyphenyl)-3-methyl-4-oxopyrido[4,3-d]pyrimidin-5-yl]amino]ethyl]carbamate (PubChem CID 66959591) has the molecular formula C20H23N5O5 and a molecular weight of 413.43 g/mol. Its IUPAC name is methyl N-[2-[[7-(3,4-dimethoxyphenyl)-3-methyl-4-oxopyrido[4,3-d]pyrimidin-5-yl]amino]ethyl]carbamate.
| Compound Name | methyl N-[2-[[7-(3,4-dimethoxyphenyl)-3-methyl-4-oxopyrido[4,3-d]pyrimidin-5-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 66959591 |
| Molecular Formula | C20H23N5O5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | methyl N-[2-[[7-(3,4-dimethoxyphenyl)-3-methyl-4-oxopyrido[4,3-d]pyrimidin-5-yl]amino]ethyl]carbamate |
| SMILES | COC(=O)NCCNc1nc(-c2ccc(OC)c(OC)c2)cc2ncn(C)c(=O)c12 |
| InChI | InChI=1S/C20H23N5O5/c1-25-11-23-14-10-13(12-5-6-15(28-2)16(9-12)29-3)24-18(17(14)19(25)26)21-7-8-22-20(27)30-4/h5-6,9-11H,7-8H2,1-4H3,(H,21,24)(H,22,27) |
| InChIKey | WGRZCNBBNQYHPA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|