C25H26FN3O2 — CID 66961903
(3E)-3-[[2-fluoro-5-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-(2-phenylethyl)piperidin-2-one (PubChem CID 66961903) has the molecular formula C25H26FN3O2 and a molecular weight of 419.50 g/mol. Its IUPAC name is (3E)-3-[[2-fluoro-5-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-(2-phenylethyl)piperidin-2-one.
| Compound Name | (3E)-3-[[2-fluoro-5-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-(2-phenylethyl)piperidin-2-one |
|---|---|
| PubChem CID | 66961903 |
| Molecular Formula | C25H26FN3O2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | (3E)-3-[[2-fluoro-5-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-(2-phenylethyl)piperidin-2-one |
| SMILES | COc1cc(/C=C2\CCCN(CCc3ccccc3)C2=O)c(F)cc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H26FN3O2/c1-18-16-29(17-27-18)23-15-22(26)21(14-24(23)31-2)13-20-9-6-11-28(25(20)30)12-10-19-7-4-3-5-8-19/h3-5,7-8,13-17H,6,9-12H2,1-2H3/b20-13+ |
| InChIKey | KEQWNZDLBSHMAL-DEDYPNTBSA-N |
| XLogP | 4.58 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|