C26H34N2O7 — CID 66962068
ethyl 3-[[(2R,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(phenylmethoxymethoxy)pyrrolidin-2-yl]methoxy]pyridine-2-carboxylate (PubChem CID 66962068) has the molecular formula C26H34N2O7 and a molecular weight of 486.57 g/mol. Its IUPAC name is ethyl 3-[[(2R,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(phenylmethoxymethoxy)pyrrolidin-2-yl]methoxy]pyridine-2-carboxylate.
| Compound Name | ethyl 3-[[(2R,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(phenylmethoxymethoxy)pyrrolidin-2-yl]methoxy]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 66962068 |
| Molecular Formula | C26H34N2O7 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | ethyl 3-[[(2R,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(phenylmethoxymethoxy)pyrrolidin-2-yl]methoxy]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1ncccc1OC[C@H]1C[C@@H](OCOCc2ccccc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H34N2O7/c1-5-32-24(29)23-22(12-9-13-27-23)33-17-20-14-21(15-28(20)25(30)35-26(2,3)4)34-18-31-16-19-10-7-6-8-11-19/h6-13,20-21H,5,14-18H2,1-4H3/t20-,21-/m1/s1 |
| InChIKey | XTEQFDZNRWIZCF-NHCUHLMSSA-N |
| XLogP | 4.21 |
| TPSA | 96.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|