C31H37NO4 — CID 67293970
tert-butyl 4-ethoxy-2-(trityloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 67293970) has the molecular formula C31H37NO4 and a molecular weight of 487.64 g/mol. Its IUPAC name is tert-butyl 4-ethoxy-2-(trityloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-ethoxy-2-(trityloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67293970 |
| Molecular Formula | C31H37NO4 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | tert-butyl 4-ethoxy-2-(trityloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CCOC1CC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C31H37NO4/c1-5-34-28-21-27(32(22-28)29(33)36-30(2,3)4)23-35-31(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,27-28H,5,21-23H2,1-4H3 |
| InChIKey | MVYHDRVWQNWVRI-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|