C25H24ClN3O3 — CID 66963996
2-methoxyethyl 2-[3-(4-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]-2-methyl-3-phenylpropanoate (PubChem CID 66963996) has the molecular formula C25H24ClN3O3 and a molecular weight of 449.94 g/mol. Its IUPAC name is 2-methoxyethyl 2-[3-(4-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]-2-methyl-3-phenylpropanoate.
| Compound Name | 2-methoxyethyl 2-[3-(4-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 66963996 |
| Molecular Formula | C25H24ClN3O3 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 2-methoxyethyl 2-[3-(4-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]-2-methyl-3-phenylpropanoate |
| SMILES | COCCOC(=O)C(C)(Cc1ccccc1)c1ccnc2c(-c3ccc(Cl)cc3)cnn12 |
| InChI | InChI=1S/C25H24ClN3O3/c1-25(24(30)32-15-14-31-2,16-18-6-4-3-5-7-18)22-12-13-27-23-21(17-28-29(22)23)19-8-10-20(26)11-9-19/h3-13,17H,14-16H2,1-2H3 |
| InChIKey | QNZGOCDWNPUGBT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|