C26H23ClN4O5 — CID 66966773
methyl 2-[4-[6-[[(4-chlorobenzoyl)amino]carbamoyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenoxy]acetate (PubChem CID 66966773) has the molecular formula C26H23ClN4O5 and a molecular weight of 506.95 g/mol. Its IUPAC name is methyl 2-[4-[6-[[(4-chlorobenzoyl)amino]carbamoyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenoxy]acetate.
| Compound Name | methyl 2-[4-[6-[[(4-chlorobenzoyl)amino]carbamoyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenoxy]acetate |
|---|---|
| PubChem CID | 66966773 |
| Molecular Formula | C26H23ClN4O5 |
| Molecular Weight | 506.95 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | methyl 2-[4-[6-[[(4-chlorobenzoyl)amino]carbamoyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenoxy]acetate |
| SMILES | COC(=O)COc1cc(C)c(-c2nc3ccc(C(=O)NNC(=O)c4ccc(Cl)cc4)cc3[nH]2)c(C)c1 |
| InChI | InChI=1S/C26H23ClN4O5/c1-14-10-19(36-13-22(32)35-3)11-15(2)23(14)24-28-20-9-6-17(12-21(20)29-24)26(34)31-30-25(33)16-4-7-18(27)8-5-16/h4-12H,13H2,1-3H3,(H,28,29)(H,30,33)(H,31,34) |
| InChIKey | XPVRPWUKEKFCCD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.95 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|