About pyrrol-1-ylurea
pyrrol-1-ylurea (PubChem CID 66968528) has the molecular formula C5H7N3O
and a molecular weight of 125.13 g/mol. Its IUPAC name is pyrrol-1-ylurea.
Molecular Properties
| Compound Name | pyrrol-1-ylurea |
| PubChem CID | 66968528 |
| Molecular Formula | C5H7N3O |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | pyrrol-1-ylurea |
| SMILES | NC(=O)Nn1cccc1 |
| InChI | InChI=1S/C5H7N3O/c6-5(9)7-8-3-1-2-4-8/h1-4H,(H3,6,7,9) |
| InChIKey | JBARIOKXBTZQEI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrol-1-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrol-1-ylurea?
The IUPAC name of pyrrol-1-ylurea (CID 66968528) is pyrrol-1-ylurea.
What is the SMILES notation for pyrrol-1-ylurea?
The canonical SMILES for pyrrol-1-ylurea is NC(=O)Nn1cccc1.
What is the InChIKey of pyrrol-1-ylurea?
The InChIKey is JBARIOKXBTZQEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O/c6-5(9)7-8-3-1-2-4-8/h1-4H,(H3,6,7,9).
What are the key properties of pyrrol-1-ylurea?
pyrrol-1-ylurea has a molecular weight of 125.13 g/mol, XLogP of 0.11, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrol-1-ylurea is sourced from PubChem (CID 66968528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).