C25H27ClFN3O — CID 66968562
4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(4-fluoronaphthalen-1-yl)pyrrolidin-3-ol (PubChem CID 66968562) has the molecular formula C25H27ClFN3O and a molecular weight of 439.96 g/mol. Its IUPAC name is 4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(4-fluoronaphthalen-1-yl)pyrrolidin-3-ol.
| Compound Name | 4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(4-fluoronaphthalen-1-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 66968562 |
| Molecular Formula | C25H27ClFN3O |
| Molecular Weight | 439.96 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(4-fluoronaphthalen-1-yl)pyrrolidin-3-ol |
| SMILES | OC1CN(c2ccc(F)c3ccccc23)CC1N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H27ClFN3O/c26-19-7-5-18(6-8-19)15-28-11-13-29(14-12-28)24-16-30(17-25(24)31)23-10-9-22(27)20-3-1-2-4-21(20)23/h1-10,24-25,31H,11-17H2 |
| InChIKey | FGUBRYCJZGZNKE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.96 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |