C23H25Cl2N5O — CID 66968484
4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(7-chloroquinoxalin-2-yl)pyrrolidin-3-ol (PubChem CID 66968484) has the molecular formula C23H25Cl2N5O and a molecular weight of 458.39 g/mol. Its IUPAC name is 4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(7-chloroquinoxalin-2-yl)pyrrolidin-3-ol.
| Compound Name | 4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(7-chloroquinoxalin-2-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 66968484 |
| Molecular Formula | C23H25Cl2N5O |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(7-chloroquinoxalin-2-yl)pyrrolidin-3-ol |
| SMILES | OC1CN(c2cnc3ccc(Cl)cc3n2)CC1N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H25Cl2N5O/c24-17-3-1-16(2-4-17)13-28-7-9-29(10-8-28)21-14-30(15-22(21)31)23-12-26-19-6-5-18(25)11-20(19)27-23/h1-6,11-12,21-22,31H,7-10,13-15H2 |
| InChIKey | XMFFZFQDKSXNLJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |