C35H54Cl2N4O3 — CID 66971289
N-[(3S,5S)-5-(acetamidomethyl)-1-[(3S)-1-tert-butyl-2-(2,4-dichlorophenyl)pyrrolidine-3-carbonyl]pyrrolidin-3-yl]-N-(4,4-dimethylcyclohexyl)-2,2-dimethylpropanamide (PubChem CID 66971289) has the molecular formula C35H54Cl2N4O3 and a molecular weight of 649.75 g/mol. Its IUPAC name is N-[(3S,5S)-5-(acetamidomethyl)-1-[(3S)-1-tert-butyl-2-(2,4-dichlorophenyl)pyrrolidine-3-carbonyl]pyrrolidin-3-yl]-N-(4,4-dimethylcyclohexyl)-2,2-dimethylpropanamide.
| Compound Name | N-[(3S,5S)-5-(acetamidomethyl)-1-[(3S)-1-tert-butyl-2-(2,4-dichlorophenyl)pyrrolidine-3-carbonyl]pyrrolidin-3-yl]-N-(4,4-dimethylcyclohexyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 66971289 |
| Molecular Formula | C35H54Cl2N4O3 |
| Molecular Weight | 649.75 g/mol |
| Exact Mass | 648.36 |
| IUPAC Name | N-[(3S,5S)-5-(acetamidomethyl)-1-[(3S)-1-tert-butyl-2-(2,4-dichlorophenyl)pyrrolidine-3-carbonyl]pyrrolidin-3-yl]-N-(4,4-dimethylcyclohexyl)-2,2-dimethylpropanamide |
| SMILES | CC(=O)NC[C@@H]1C[C@H](N(C(=O)C(C)(C)C)C2CCC(C)(C)CC2)CN1C(=O)[C@H]1CCN(C(C)(C)C)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C35H54Cl2N4O3/c1-22(42)38-20-25-19-26(41(32(44)33(2,3)4)24-12-15-35(8,9)16-13-24)21-39(25)31(43)28-14-17-40(34(5,6)7)30(28)27-11-10-23(36)18-29(27)37/h10-11,18,24-26,28,30H,12-17,19-21H2,1-9H3,(H,38,42)/t25-,26-,28-,30?/m0/s1 |
| InChIKey | VKUAWPXPQOIJHH-DYRZYVISSA-N |
| XLogP | 7.10 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.75 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |