C23H29N5O2 — CID 66971321
1-[(1-methylpiperidin-2-yl)methyl]-3-[4-(2-oxo-4-phenylpyrrolidin-1-yl)-2-pyridinyl]urea (PubChem CID 66971321) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-[(1-methylpiperidin-2-yl)methyl]-3-[4-(2-oxo-4-phenylpyrrolidin-1-yl)-2-pyridinyl]urea.
| Compound Name | 1-[(1-methylpiperidin-2-yl)methyl]-3-[4-(2-oxo-4-phenylpyrrolidin-1-yl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 66971321 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 1-[(1-methylpiperidin-2-yl)methyl]-3-[4-(2-oxo-4-phenylpyrrolidin-1-yl)-2-pyridinyl]urea |
| SMILES | CN1CCCCC1CNC(=O)Nc1cc(N2CC(c3ccccc3)CC2=O)ccn1 |
| InChI | InChI=1S/C23H29N5O2/c1-27-12-6-5-9-20(27)15-25-23(30)26-21-14-19(10-11-24-21)28-16-18(13-22(28)29)17-7-3-2-4-8-17/h2-4,7-8,10-11,14,18,20H,5-6,9,12-13,15-16H2,1H3,(H2,24,25,26,30) |
| InChIKey | KQVSFTRTEOTQHR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |