C6H4ClF3N2O2 — CID 66972063
6-(chloromethyl)-5-(trifluoromethyl)-1H-pyrimidine-2,4-dione (PubChem CID 66972063) has the molecular formula C6H4ClF3N2O2 and a molecular weight of 228.56 g/mol. Its IUPAC name is 6-(chloromethyl)-5-(trifluoromethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(chloromethyl)-5-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66972063 |
| Molecular Formula | C6H4ClF3N2O2 |
| Molecular Weight | 228.56 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 6-(chloromethyl)-5-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(CCl)c(C(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C6H4ClF3N2O2/c7-1-2-3(6(8,9)10)4(13)12-5(14)11-2/h1H2,(H2,11,12,13,14) |
| InChIKey | ZDJQXJJPTAIZRL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.56 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|