C10H9N2O3S- — CID 66972805
2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanesulfinate (PubChem CID 66972805) has the molecular formula C10H9N2O3S- and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanesulfinate.
| Compound Name | 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanesulfinate |
|---|---|
| PubChem CID | 66972805 |
| Molecular Formula | C10H9N2O3S- |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanesulfinate |
| SMILES | O=S([O-])CCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C10H10N2O3S/c13-16(14)7-6-9-11-10(12-15-9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,13,14)/p-1 |
| InChIKey | IDWMOBQFNPOECI-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|