C25H38Cl2N4O3 — CID 66973097
(3S,8aS)-2-[(2S)-2-amino-2-cyclohexylacetyl]-N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-3-carboxamide;dihydrochloride (PubChem CID 66973097) has the molecular formula C25H38Cl2N4O3 and a molecular weight of 513.51 g/mol. Its IUPAC name is (3S,8aS)-2-[(2S)-2-amino-2-cyclohexylacetyl]-N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-3-carboxamide;dihydrochloride.
| Compound Name | (3S,8aS)-2-[(2S)-2-amino-2-cyclohexylacetyl]-N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 66973097 |
| Molecular Formula | C25H38Cl2N4O3 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | (3S,8aS)-2-[(2S)-2-amino-2-cyclohexylacetyl]-N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.N[C@H](C(=O)N1C[C@@H]2CCCN2C[C@H]1C(=O)N[C@@H]1CCOc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C25H36N4O3.2ClH/c26-23(17-7-2-1-3-8-17)25(31)29-15-18-9-6-13-28(18)16-21(29)24(30)27-20-12-14-32-22-11-5-4-10-19(20)22;;/h4-5,10-11,17-18,20-21,23H,1-3,6-9,12-16,26H2,(H,27,30);2*1H/t18-,20+,21-,23-;;/m0../s1 |
| InChIKey | IVQKITQOHOHOTA-YHSRVVKQSA-N |
| XLogP | 3.05 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |