C14H13F4NO3 — CID 66973660
methyl 4-fluoro-7-methyl-1-[2-(trifluoromethoxy)ethyl]indole-3-carboxylate (PubChem CID 66973660) has the molecular formula C14H13F4NO3 and a molecular weight of 319.25 g/mol. Its IUPAC name is methyl 4-fluoro-7-methyl-1-[2-(trifluoromethoxy)ethyl]indole-3-carboxylate.
| Compound Name | methyl 4-fluoro-7-methyl-1-[2-(trifluoromethoxy)ethyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 66973660 |
| Molecular Formula | C14H13F4NO3 |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | methyl 4-fluoro-7-methyl-1-[2-(trifluoromethoxy)ethyl]indole-3-carboxylate |
| SMILES | COC(=O)c1cn(CCOC(F)(F)F)c2c(C)ccc(F)c12 |
| InChI | InChI=1S/C14H13F4NO3/c1-8-3-4-10(15)11-9(13(20)21-2)7-19(12(8)11)5-6-22-14(16,17)18/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | IXXDUBLGYJMDKS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |