5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid

C14H17NO5 — CID 66973768

IUPAC5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid
SMILESCOCCn1cc(C(=O)O)c2cc(OC)c(OC)cc21
InChIInChI=1S/C14H17NO5/c1-18-5-4-15-8-10(14(16)17)9-6-12(19-2)13(20-3)7-11(9)15/h6-8H,4-5H2,1-3H3,(H,16,17)
InChIKeyJLAHRASEBIROIS-UHFFFAOYSA-N
MW279.29 g/mol
LogP2.00
Rot. Bonds6

About 5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid

5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid (PubChem CID 66973768) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid.

Molecular Properties

Compound Name5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid
PubChem CID66973768
Molecular FormulaC14H17NO5
Molecular Weight279.29 g/mol
Exact Mass279.11
IUPAC Name5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid
SMILESCOCCn1cc(C(=O)O)c2cc(OC)c(OC)cc21
InChIInChI=1S/C14H17NO5/c1-18-5-4-15-8-10(14(16)17)9-6-12(19-2)13(20-3)7-11(9)15/h6-8H,4-5H2,1-3H3,(H,16,17)
InChIKeyJLAHRASEBIROIS-UHFFFAOYSA-N
XLogP2.00
TPSA69.92 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.29
LogP ≤ 52.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid?
The IUPAC name of 5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid (CID 66973768) is 5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid.
What is the SMILES notation for 5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid?
The canonical SMILES for 5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid is COCCn1cc(C(=O)O)c2cc(OC)c(OC)cc21.
What is the InChIKey of 5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid?
The InChIKey is JLAHRASEBIROIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO5/c1-18-5-4-15-8-10(14(16)17)9-6-12(19-2)13(20-3)7-11(9)15/h6-8H,4-5H2,1-3H3,(H,16,17).
What are the key properties of 5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid?
5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid has a molecular weight of 279.29 g/mol, XLogP of 2.00, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethoxy-1-(2-methoxyethyl)indole-3-carboxylic acid is sourced from PubChem (CID 66973768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).