C14H17NO5 — CID 83947486
1-(3-hydroxypropyl)-5,6-dimethoxyindole-3-carboxylic acid (PubChem CID 83947486) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-5,6-dimethoxyindole-3-carboxylic acid.
| Compound Name | 1-(3-hydroxypropyl)-5,6-dimethoxyindole-3-carboxylic acid |
|---|---|
| PubChem CID | 83947486 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-(3-hydroxypropyl)-5,6-dimethoxyindole-3-carboxylic acid |
| SMILES | COc1cc2c(C(=O)O)cn(CCCO)c2cc1OC |
| InChI | InChI=1S/C14H17NO5/c1-19-12-6-9-10(14(17)18)8-15(4-3-5-16)11(9)7-13(12)20-2/h6-8,16H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | KMAXFEWWGRWYNJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |