C25H31NO6 — CID 45270426
[1-(6-hydroxyhexyl)-6-methoxyindol-3-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 45270426) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is [1-(6-hydroxyhexyl)-6-methoxyindol-3-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [1-(6-hydroxyhexyl)-6-methoxyindol-3-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 45270426 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | [1-(6-hydroxyhexyl)-6-methoxyindol-3-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1ccc2c(C(=O)c3cc(OC)c(OC)c(OC)c3)cn(CCCCCCO)c2c1 |
| InChI | InChI=1S/C25H31NO6/c1-29-18-9-10-19-20(16-26(21(19)15-18)11-7-5-6-8-12-27)24(28)17-13-22(30-2)25(32-4)23(14-17)31-3/h9-10,13-16,27H,5-8,11-12H2,1-4H3 |
| InChIKey | KREHXAPBHXTACZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|