C24H27NO8 — CID 67077480
tert-butyl [6-methoxy-3-(3,4,5-trimethoxybenzoyl)indol-1-yl] carbonate (PubChem CID 67077480) has the molecular formula C24H27NO8 and a molecular weight of 457.48 g/mol. Its IUPAC name is tert-butyl [6-methoxy-3-(3,4,5-trimethoxybenzoyl)indol-1-yl] carbonate.
| Compound Name | tert-butyl [6-methoxy-3-(3,4,5-trimethoxybenzoyl)indol-1-yl] carbonate |
|---|---|
| PubChem CID | 67077480 |
| Molecular Formula | C24H27NO8 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | tert-butyl [6-methoxy-3-(3,4,5-trimethoxybenzoyl)indol-1-yl] carbonate |
| SMILES | COc1ccc2c(C(=O)c3cc(OC)c(OC)c(OC)c3)cn(OC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C24H27NO8/c1-24(2,3)32-23(27)33-25-13-17(16-9-8-15(28-4)12-18(16)25)21(26)14-10-19(29-5)22(31-7)20(11-14)30-6/h8-13H,1-7H3 |
| InChIKey | WWWVQKSFKBBGNU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 94.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |