C19H19NO7 — CID 143584965
(1,7-dihydroxy-6-methoxyindol-3-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 143584965) has the molecular formula C19H19NO7 and a molecular weight of 373.36 g/mol. Its IUPAC name is (1,7-dihydroxy-6-methoxyindol-3-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (1,7-dihydroxy-6-methoxyindol-3-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 143584965 |
| Molecular Formula | C19H19NO7 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (1,7-dihydroxy-6-methoxyindol-3-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2cn(O)c3c(O)c(OC)ccc23)cc(OC)c1OC |
| InChI | InChI=1S/C19H19NO7/c1-24-13-6-5-11-12(9-20(23)16(11)18(13)22)17(21)10-7-14(25-2)19(27-4)15(8-10)26-3/h5-9,22-23H,1-4H3 |
| InChIKey | YIHPGEGCKWUTCW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|