C26H23NO8 — CID 67077417
[6-methoxy-3-(3,4,5-trimethoxybenzoyl)indol-1-yl] phenyl carbonate (PubChem CID 67077417) has the molecular formula C26H23NO8 and a molecular weight of 477.47 g/mol. Its IUPAC name is [6-methoxy-3-(3,4,5-trimethoxybenzoyl)indol-1-yl] phenyl carbonate.
| Compound Name | [6-methoxy-3-(3,4,5-trimethoxybenzoyl)indol-1-yl] phenyl carbonate |
|---|---|
| PubChem CID | 67077417 |
| Molecular Formula | C26H23NO8 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | [6-methoxy-3-(3,4,5-trimethoxybenzoyl)indol-1-yl] phenyl carbonate |
| SMILES | COc1ccc2c(C(=O)c3cc(OC)c(OC)c(OC)c3)cn(OC(=O)Oc3ccccc3)c2c1 |
| InChI | InChI=1S/C26H23NO8/c1-30-18-10-11-19-20(24(28)16-12-22(31-2)25(33-4)23(13-16)32-3)15-27(21(19)14-18)35-26(29)34-17-8-6-5-7-9-17/h5-15H,1-4H3 |
| InChIKey | STNFQOPTOCNPNJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 94.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|