C23H23BrO2 — CID 66975527
(4'R,4'aS)-4'-benzyl-7'-bromospiro[1,3-dioxolane-2,2'-3,4,4a,9-tetrahydro-1H-phenanthrene] (PubChem CID 66975527) has the molecular formula C23H23BrO2 and a molecular weight of 411.34 g/mol. Its IUPAC name is (4'R,4'aS)-4'-benzyl-7'-bromospiro[1,3-dioxolane-2,2'-3,4,4a,9-tetrahydro-1H-phenanthrene].
| Compound Name | (4'R,4'aS)-4'-benzyl-7'-bromospiro[1,3-dioxolane-2,2'-3,4,4a,9-tetrahydro-1H-phenanthrene] |
|---|---|
| PubChem CID | 66975527 |
| Molecular Formula | C23H23BrO2 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (4'R,4'aS)-4'-benzyl-7'-bromospiro[1,3-dioxolane-2,2'-3,4,4a,9-tetrahydro-1H-phenanthrene] |
| SMILES | Brc1ccc2c(c1)CC=C1CC3(C[C@@H](Cc4ccccc4)[C@@H]12)OCCO3 |
| InChI | InChI=1S/C23H23BrO2/c24-20-8-9-21-17(13-20)6-7-18-14-23(25-10-11-26-23)15-19(22(18)21)12-16-4-2-1-3-5-16/h1-5,7-9,13,19,22H,6,10-12,14-15H2/t19-,22-/m1/s1 |
| InChIKey | QBNRAXWTSXDKPQ-DENIHFKCSA-N |
| XLogP | 5.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|