C14H17Cl2F3N2O3S — CID 66976460
N-[[(6R,7S)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methyl]-2,2,2-trifluoroethanesulfonamide (PubChem CID 66976460) has the molecular formula C14H17Cl2F3N2O3S and a molecular weight of 421.27 g/mol. Its IUPAC name is N-[[(6R,7S)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methyl]-2,2,2-trifluoroethanesulfonamide.
| Compound Name | N-[[(6R,7S)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methyl]-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 66976460 |
| Molecular Formula | C14H17Cl2F3N2O3S |
| Molecular Weight | 421.27 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | N-[[(6R,7S)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methyl]-2,2,2-trifluoroethanesulfonamide |
| SMILES | O=S(=O)(CC(F)(F)F)NC[C@H]1OCCNC[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2F3N2O3S/c15-11-2-1-9(5-12(11)16)10-6-20-3-4-24-13(10)7-21-25(22,23)8-14(17,18)19/h1-2,5,10,13,20-21H,3-4,6-8H2/t10-,13+/m0/s1 |
| InChIKey | RCKSCFHYUOEOJL-GXFFZTMASA-N |
| XLogP | 2.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |