C14H14ClN3 — CID 66980472
5-[(1S,2R)-2-aminocyclopropyl]-3-(3-chlorophenyl)pyridin-2-amine (PubChem CID 66980472) has the molecular formula C14H14ClN3 and a molecular weight of 259.74 g/mol. Its IUPAC name is 5-[(1S,2R)-2-aminocyclopropyl]-3-(3-chlorophenyl)pyridin-2-amine.
| Compound Name | 5-[(1S,2R)-2-aminocyclopropyl]-3-(3-chlorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 66980472 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 5-[(1S,2R)-2-aminocyclopropyl]-3-(3-chlorophenyl)pyridin-2-amine |
| SMILES | Nc1ncc([C@@H]2C[C@H]2N)cc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H14ClN3/c15-10-3-1-2-8(4-10)12-5-9(7-18-14(12)17)11-6-13(11)16/h1-5,7,11,13H,6,16H2,(H2,17,18)/t11-,13+/m0/s1 |
| InChIKey | AYVRWJFJATYUIJ-WCQYABFASA-N |
| XLogP | 2.80 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |