C15H17Cl2N3 — CID 66980585
5-(2-aminocyclopropyl)-N-[(3-chlorophenyl)methyl]pyridin-2-amine;hydrochloride (PubChem CID 66980585) has the molecular formula C15H17Cl2N3 and a molecular weight of 310.23 g/mol. Its IUPAC name is 5-(2-aminocyclopropyl)-N-[(3-chlorophenyl)methyl]pyridin-2-amine;hydrochloride.
| Compound Name | 5-(2-aminocyclopropyl)-N-[(3-chlorophenyl)methyl]pyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 66980585 |
| Molecular Formula | C15H17Cl2N3 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 5-(2-aminocyclopropyl)-N-[(3-chlorophenyl)methyl]pyridin-2-amine;hydrochloride |
| SMILES | Cl.NC1CC1c1ccc(NCc2cccc(Cl)c2)nc1 |
| InChI | InChI=1S/C15H16ClN3.ClH/c16-12-3-1-2-10(6-12)8-18-15-5-4-11(9-19-15)13-7-14(13)17;/h1-6,9,13-14H,7-8,17H2,(H,18,19);1H |
| InChIKey | LTPSQIHMHBJHEO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |