C11H14ClF2N — CID 66982930
3-fluoro-2-[(4-fluoro-3-methylphenyl)methyl]prop-2-en-1-amine;hydrochloride (PubChem CID 66982930) has the molecular formula C11H14ClF2N and a molecular weight of 233.69 g/mol. Its IUPAC name is 3-fluoro-2-[(4-fluoro-3-methylphenyl)methyl]prop-2-en-1-amine;hydrochloride.
| Compound Name | 3-fluoro-2-[(4-fluoro-3-methylphenyl)methyl]prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 66982930 |
| Molecular Formula | C11H14ClF2N |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 3-fluoro-2-[(4-fluoro-3-methylphenyl)methyl]prop-2-en-1-amine;hydrochloride |
| SMILES | Cc1cc(CC(=CF)CN)ccc1F.Cl |
| InChI | InChI=1S/C11H13F2N.ClH/c1-8-4-9(2-3-11(8)13)5-10(6-12)7-14;/h2-4,6H,5,7,14H2,1H3;1H |
| InChIKey | NJFQAJFNDUPJSL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |