C22H39NO2 — CID 66985808
3-octadec-9-enyl-2H-1,3-oxazin-6-one (PubChem CID 66985808) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is 3-octadec-9-enyl-2H-1,3-oxazin-6-one.
| Compound Name | 3-octadec-9-enyl-2H-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 66985808 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | 3-octadec-9-enyl-2H-1,3-oxazin-6-one |
| SMILES | CCCCCCCCC=CCCCCCCCCN1C=CC(=O)OC1 |
| InChI | InChI=1S/C22H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-23-20-18-22(24)25-21-23/h9-10,18,20H,2-8,11-17,19,21H2,1H3 |
| InChIKey | PFYPMQDSRXTRLX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|