About CID 66989853
CID 66989853 (PubChem CID 66989853) has the molecular formula C14H13ClSi
and a molecular weight of 244.80 g/mol.
Molecular Properties
| Compound Name | CID 66989853 |
| PubChem CID | 66989853 |
| Molecular Formula | C14H13ClSi |
| Molecular Weight | 244.80 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1C([Si]Cl)c1ccccc1 |
| InChI | InChI=1S/C14H13ClSi/c1-11-7-5-6-10-13(11)14(16-15)12-8-3-2-4-9-12/h2-10,14H,1H3 |
| InChIKey | FKBCBHBHRMRBNH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 66989853 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66989853?
The IUPAC name of CID 66989853 (CID 66989853) is not available.
What is the SMILES notation for CID 66989853?
The canonical SMILES for CID 66989853 is Cc1ccccc1C([Si]Cl)c1ccccc1.
What is the InChIKey of CID 66989853?
The InChIKey is FKBCBHBHRMRBNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClSi/c1-11-7-5-6-10-13(11)14(16-15)12-8-3-2-4-9-12/h2-10,14H,1H3.
What are the key properties of CID 66989853?
CID 66989853 has a molecular weight of 244.80 g/mol, XLogP of 3.94, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66989853 is sourced from PubChem (CID 66989853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).