C27H27N5O4S — CID 6699089
N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 6699089) has the molecular formula C27H27N5O4S and a molecular weight of 517.61 g/mol. Its IUPAC name is N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6699089 |
| Molecular Formula | C27H27N5O4S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc([C@H]2O[C@@H](CSc3ncn[nH]3)C[C@@H](c3ccc(CO)cc3)O2)cc1)c1cccnc1 |
| InChI | InChI=1S/C27H27N5O4S/c33-15-19-5-7-20(8-6-19)24-12-23(16-37-27-30-17-31-32-27)35-26(36-24)21-9-3-18(4-10-21)13-29-25(34)22-2-1-11-28-14-22/h1-11,14,17,23-24,26,33H,12-13,15-16H2,(H,29,34)(H,30,31,32)/t23-,24+,26+/m1/s1 |
| InChIKey | RNNRHIJWVUCOIG-USZFVNFHSA-N |
| XLogP | 3.96 |
| TPSA | 122.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |